C29H33FN2O4 — CID 86275672
7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]spiro[3H-chromene-2,1'-cyclohexane]-4-one (PubChem CID 86275672) has the molecular formula C29H33FN2O4 and a molecular weight of 492.59 g/mol. Its IUPAC name is 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]spiro[3H-chromene-2,1'-cyclohexane]-4-one.
| Compound Name | 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]spiro[3H-chromene-2,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 86275672 |
| Molecular Formula | C29H33FN2O4 |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]spiro[3H-chromene-2,1'-cyclohexane]-4-one |
| SMILES | O=C1CC2(CCCCC2)Oc2cc(OCCCN3CCC(c4noc5cc(F)ccc45)CC3)ccc21 |
| InChI | InChI=1S/C29H33FN2O4/c30-21-5-7-24-27(17-21)36-31-28(24)20-9-14-32(15-10-20)13-4-16-34-22-6-8-23-25(33)19-29(35-26(23)18-22)11-2-1-3-12-29/h5-8,17-18,20H,1-4,9-16,19H2 |
| InChIKey | WHLTZXCYSBAUBN-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|