C21H24N2O2S — CID 86276221
4-methyl-2-(10H-phenothiazin-2-yl)-4a,5,6,7,8,8a-hexahydro-3H-benzo[b][1,4]oxazin-2-ol (PubChem CID 86276221) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is 4-methyl-2-(10H-phenothiazin-2-yl)-4a,5,6,7,8,8a-hexahydro-3H-benzo[b][1,4]oxazin-2-ol.
| Compound Name | 4-methyl-2-(10H-phenothiazin-2-yl)-4a,5,6,7,8,8a-hexahydro-3H-benzo[b][1,4]oxazin-2-ol |
|---|---|
| PubChem CID | 86276221 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 4-methyl-2-(10H-phenothiazin-2-yl)-4a,5,6,7,8,8a-hexahydro-3H-benzo[b][1,4]oxazin-2-ol |
| SMILES | CN1CC(O)(c2ccc3c(c2)Nc2ccccc2S3)OC2CCCCC21 |
| InChI | InChI=1S/C21H24N2O2S/c1-23-13-21(24,25-18-8-4-3-7-17(18)23)14-10-11-20-16(12-14)22-15-6-2-5-9-19(15)26-20/h2,5-6,9-12,17-18,22,24H,3-4,7-8,13H2,1H3 |
| InChIKey | RKNYLNHGFOONQP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |