C23H16Br2N2O2 — CID 86276283
4-[bis(5-bromo-1H-indol-3-yl)methyl]benzene-1,3-diol (PubChem CID 86276283) has the molecular formula C23H16Br2N2O2 and a molecular weight of 512.20 g/mol. Its IUPAC name is 4-[bis(5-bromo-1H-indol-3-yl)methyl]benzene-1,3-diol.
| Compound Name | 4-[bis(5-bromo-1H-indol-3-yl)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 86276283 |
| Molecular Formula | C23H16Br2N2O2 |
| Molecular Weight | 512.20 g/mol |
| Exact Mass | 509.96 |
| IUPAC Name | 4-[bis(5-bromo-1H-indol-3-yl)methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(C(c2c[nH]c3ccc(Br)cc23)c2c[nH]c3ccc(Br)cc23)c(O)c1 |
| InChI | InChI=1S/C23H16Br2N2O2/c24-12-1-5-20-16(7-12)18(10-26-20)23(15-4-3-14(28)9-22(15)29)19-11-27-21-6-2-13(25)8-17(19)21/h1-11,23,26-29H |
| InChIKey | GZDKFJISBISDKY-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.20 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |