C22H30O3 — CID 86276423
methyl (1R,2R,3R,4S)-1-hydroxy-3-methyl-2-(6-methylhepta-1,5-dien-2-yl)-4-phenylcyclopentane-1-carboxylate (PubChem CID 86276423) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is methyl (1R,2R,3R,4S)-1-hydroxy-3-methyl-2-(6-methylhepta-1,5-dien-2-yl)-4-phenylcyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2R,3R,4S)-1-hydroxy-3-methyl-2-(6-methylhepta-1,5-dien-2-yl)-4-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 86276423 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | methyl (1R,2R,3R,4S)-1-hydroxy-3-methyl-2-(6-methylhepta-1,5-dien-2-yl)-4-phenylcyclopentane-1-carboxylate |
| SMILES | C=C(CCC=C(C)C)[C@H]1[C@H](C)[C@@H](c2ccccc2)C[C@]1(O)C(=O)OC |
| InChI | InChI=1S/C22H30O3/c1-15(2)10-9-11-16(3)20-17(4)19(18-12-7-6-8-13-18)14-22(20,24)21(23)25-5/h6-8,10,12-13,17,19-20,24H,3,9,11,14H2,1-2,4-5H3/t17-,19+,20+,22-/m1/s1 |
| InChIKey | CNJUGARGLPTJSV-IWLVTHKOSA-N |
| XLogP | 4.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|