C20H28O3 — CID 86276427
methyl (1R,2S,3R,4S)-2-[(E)-hex-1-enyl]-1-hydroxy-3-methyl-4-phenylcyclopentane-1-carboxylate (PubChem CID 86276427) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is methyl (1R,2S,3R,4S)-2-[(E)-hex-1-enyl]-1-hydroxy-3-methyl-4-phenylcyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2S,3R,4S)-2-[(E)-hex-1-enyl]-1-hydroxy-3-methyl-4-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 86276427 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | methyl (1R,2S,3R,4S)-2-[(E)-hex-1-enyl]-1-hydroxy-3-methyl-4-phenylcyclopentane-1-carboxylate |
| SMILES | CCCC/C=C/[C@H]1[C@H](C)[C@@H](c2ccccc2)C[C@]1(O)C(=O)OC |
| InChI | InChI=1S/C20H28O3/c1-4-5-6-10-13-18-15(2)17(16-11-8-7-9-12-16)14-20(18,22)19(21)23-3/h7-13,15,17-18,22H,4-6,14H2,1-3H3/b13-10+/t15-,17+,18+,20-/m1/s1 |
| InChIKey | DRANJERHSDAQJL-FCGVUBNRSA-N |
| XLogP | 4.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|