About 5-fluorospiro[2,4-dihydro-1H-quinoline-3,4'-oxane]
5-fluorospiro[2,4-dihydro-1H-quinoline-3,4'-oxane] (PubChem CID 86277174) has the molecular formula C13H16FNO
and a molecular weight of 221.27 g/mol. Its IUPAC name is 5-fluorospiro[2,4-dihydro-1H-quinoline-3,4'-oxane].
Molecular Properties
| Compound Name | 5-fluorospiro[2,4-dihydro-1H-quinoline-3,4'-oxane] |
| PubChem CID | 86277174 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 5-fluorospiro[2,4-dihydro-1H-quinoline-3,4'-oxane] |
| SMILES | Fc1cccc2c1CC1(CCOCC1)CN2 |
| InChI | InChI=1S/C13H16FNO/c14-11-2-1-3-12-10(11)8-13(9-15-12)4-6-16-7-5-13/h1-3,15H,4-9H2 |
| InChIKey | OVOBKUGOBJDCNU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluorospiro[2,4-dihydro-1H-quinoline-3,4'-oxane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluorospiro[2,4-dihydro-1H-quinoline-3,4'-oxane]?
The IUPAC name of 5-fluorospiro[2,4-dihydro-1H-quinoline-3,4'-oxane] (CID 86277174) is 5-fluorospiro[2,4-dihydro-1H-quinoline-3,4'-oxane].
What is the SMILES notation for 5-fluorospiro[2,4-dihydro-1H-quinoline-3,4'-oxane]?
The canonical SMILES for 5-fluorospiro[2,4-dihydro-1H-quinoline-3,4'-oxane] is Fc1cccc2c1CC1(CCOCC1)CN2.
What is the InChIKey of 5-fluorospiro[2,4-dihydro-1H-quinoline-3,4'-oxane]?
The InChIKey is OVOBKUGOBJDCNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FNO/c14-11-2-1-3-12-10(11)8-13(9-15-12)4-6-16-7-5-13/h1-3,15H,4-9H2.
What are the key properties of 5-fluorospiro[2,4-dihydro-1H-quinoline-3,4'-oxane]?
5-fluorospiro[2,4-dihydro-1H-quinoline-3,4'-oxane] has a molecular weight of 221.27 g/mol, XLogP of 2.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluorospiro[2,4-dihydro-1H-quinoline-3,4'-oxane] is sourced from PubChem (CID 86277174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).