About tert-butyl-[(1S,6S)-6-methylcyclohex-2-en-1-yl]oxy-diphenylsilane
tert-butyl-[(1S,6S)-6-methylcyclohex-2-en-1-yl]oxy-diphenylsilane (PubChem CID 86277866) has the molecular formula C23H30OSi
and a molecular weight of 350.58 g/mol. Its IUPAC name is tert-butyl-[(1S,6S)-6-methylcyclohex-2-en-1-yl]oxy-diphenylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(1S,6S)-6-methylcyclohex-2-en-1-yl]oxy-diphenylsilane |
| PubChem CID | 86277866 |
| Molecular Formula | C23H30OSi |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | tert-butyl-[(1S,6S)-6-methylcyclohex-2-en-1-yl]oxy-diphenylsilane |
| SMILES | C[C@H]1CCC=C[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H30OSi/c1-19-13-11-12-18-22(19)24-25(23(2,3)4,20-14-7-5-8-15-20)21-16-9-6-10-17-21/h5-10,12,14-19,22H,11,13H2,1-4H3/t19-,22+/m0/s1 |
| InChIKey | COENMYFLIZCTHW-SIKLNZKXSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(1S,6S)-6-methylcyclohex-2-en-1-yl]oxy-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(1S,6S)-6-methylcyclohex-2-en-1-yl]oxy-diphenylsilane?
The IUPAC name of tert-butyl-[(1S,6S)-6-methylcyclohex-2-en-1-yl]oxy-diphenylsilane (CID 86277866) is tert-butyl-[(1S,6S)-6-methylcyclohex-2-en-1-yl]oxy-diphenylsilane.
What is the SMILES notation for tert-butyl-[(1S,6S)-6-methylcyclohex-2-en-1-yl]oxy-diphenylsilane?
The canonical SMILES for tert-butyl-[(1S,6S)-6-methylcyclohex-2-en-1-yl]oxy-diphenylsilane is C[C@H]1CCC=C[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of tert-butyl-[(1S,6S)-6-methylcyclohex-2-en-1-yl]oxy-diphenylsilane?
The InChIKey is COENMYFLIZCTHW-SIKLNZKXSA-N. The full InChI is InChI=1S/C23H30OSi/c1-19-13-11-12-18-22(19)24-25(23(2,3)4,20-14-7-5-8-15-20)21-16-9-6-10-17-21/h5-10,12,14-19,22H,11,13H2,1-4H3/t19-,22+/m0/s1.
What are the key properties of tert-butyl-[(1S,6S)-6-methylcyclohex-2-en-1-yl]oxy-diphenylsilane?
tert-butyl-[(1S,6S)-6-methylcyclohex-2-en-1-yl]oxy-diphenylsilane has a molecular weight of 350.58 g/mol, XLogP of 4.92, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(1S,6S)-6-methylcyclohex-2-en-1-yl]oxy-diphenylsilane is sourced from PubChem (CID 86277866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).