About 4-[[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]amino]benzenesulfonamide
4-[[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]amino]benzenesulfonamide (PubChem CID 86278564) has the molecular formula C14H18N4O3S
and a molecular weight of 322.39 g/mol. Its IUPAC name is 4-[[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]amino]benzenesulfonamide |
| PubChem CID | 86278564 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 4-[[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]amino]benzenesulfonamide |
| SMILES | Cc1cc(C)n(C(=O)CCNc2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C14H18N4O3S/c1-10-9-11(2)18(17-10)14(19)7-8-16-12-3-5-13(6-4-12)22(15,20)21/h3-6,9,16H,7-8H2,1-2H3,(H2,15,20,21) |
| InChIKey | SQGUOOCGLKRFBU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]amino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]amino]benzenesulfonamide?
The IUPAC name of 4-[[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]amino]benzenesulfonamide (CID 86278564) is 4-[[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]amino]benzenesulfonamide.
What is the SMILES notation for 4-[[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]amino]benzenesulfonamide?
The canonical SMILES for 4-[[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]amino]benzenesulfonamide is Cc1cc(C)n(C(=O)CCNc2ccc(S(N)(=O)=O)cc2)n1.
What is the InChIKey of 4-[[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]amino]benzenesulfonamide?
The InChIKey is SQGUOOCGLKRFBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O3S/c1-10-9-11(2)18(17-10)14(19)7-8-16-12-3-5-13(6-4-12)22(15,20)21/h3-6,9,16H,7-8H2,1-2H3,(H2,15,20,21).
What are the key properties of 4-[[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]amino]benzenesulfonamide?
4-[[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]amino]benzenesulfonamide has a molecular weight of 322.39 g/mol, XLogP of 1.29, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]amino]benzenesulfonamide is sourced from PubChem (CID 86278564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).