About diacetyloxymercury;phenylmethanamine
diacetyloxymercury;phenylmethanamine (PubChem CID 86278675) has the molecular formula C11H15HgNO4
and a molecular weight of 425.83 g/mol. Its IUPAC name is diacetyloxymercury;phenylmethanamine.
Molecular Properties
| Compound Name | diacetyloxymercury;phenylmethanamine |
| PubChem CID | 86278675 |
| Molecular Formula | C11H15HgNO4 |
| Molecular Weight | 425.83 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | diacetyloxymercury;phenylmethanamine |
| SMILES | CC(=O)O[Hg]OC(C)=O.NCc1ccccc1 |
| InChI | InChI=1S/C7H9N.2C2H4O2.Hg/c8-6-7-4-2-1-3-5-7;2*1-2(3)4;/h1-5H,6,8H2;2*1H3,(H,3,4);/q;;;+2/p-2 |
| InChIKey | GEEBHYHQWYGLRU-UHFFFAOYSA-L |
| XLogP | 1.17 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.83 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diacetyloxymercury;phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diacetyloxymercury;phenylmethanamine?
The IUPAC name of diacetyloxymercury;phenylmethanamine (CID 86278675) is diacetyloxymercury;phenylmethanamine.
What is the SMILES notation for diacetyloxymercury;phenylmethanamine?
The canonical SMILES for diacetyloxymercury;phenylmethanamine is CC(=O)O[Hg]OC(C)=O.NCc1ccccc1.
What is the InChIKey of diacetyloxymercury;phenylmethanamine?
The InChIKey is GEEBHYHQWYGLRU-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H9N.2C2H4O2.Hg/c8-6-7-4-2-1-3-5-7;2*1-2(3)4;/h1-5H,6,8H2;2*1H3,(H,3,4);/q;;;+2/p-2.
What are the key properties of diacetyloxymercury;phenylmethanamine?
diacetyloxymercury;phenylmethanamine has a molecular weight of 425.83 g/mol, XLogP of 1.17, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diacetyloxymercury;phenylmethanamine is sourced from PubChem (CID 86278675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).