About 4-chloro-N-(3,5-dichloro-2-pyridinyl)dithiazol-5-imine
4-chloro-N-(3,5-dichloro-2-pyridinyl)dithiazol-5-imine (PubChem CID 86278907) has the molecular formula C7H2Cl3N3S2
and a molecular weight of 298.61 g/mol. Its IUPAC name is 4-chloro-N-(3,5-dichloro-2-pyridinyl)dithiazol-5-imine.
Molecular Properties
| Compound Name | 4-chloro-N-(3,5-dichloro-2-pyridinyl)dithiazol-5-imine |
| PubChem CID | 86278907 |
| Molecular Formula | C7H2Cl3N3S2 |
| Molecular Weight | 298.61 g/mol |
| Exact Mass | 296.88 |
| IUPAC Name | 4-chloro-N-(3,5-dichloro-2-pyridinyl)dithiazol-5-imine |
| SMILES | Clc1cnc(N=c2ssnc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C7H2Cl3N3S2/c8-3-1-4(9)6(11-2-3)12-7-5(10)13-15-14-7/h1-2H |
| InChIKey | ZMKDSJOXSHRPNI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.61 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-N-(3,5-dichloro-2-pyridinyl)dithiazol-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(3,5-dichloro-2-pyridinyl)dithiazol-5-imine?
The IUPAC name of 4-chloro-N-(3,5-dichloro-2-pyridinyl)dithiazol-5-imine (CID 86278907) is 4-chloro-N-(3,5-dichloro-2-pyridinyl)dithiazol-5-imine.
What is the SMILES notation for 4-chloro-N-(3,5-dichloro-2-pyridinyl)dithiazol-5-imine?
The canonical SMILES for 4-chloro-N-(3,5-dichloro-2-pyridinyl)dithiazol-5-imine is Clc1cnc(N=c2ssnc2Cl)c(Cl)c1.
What is the InChIKey of 4-chloro-N-(3,5-dichloro-2-pyridinyl)dithiazol-5-imine?
The InChIKey is ZMKDSJOXSHRPNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2Cl3N3S2/c8-3-1-4(9)6(11-2-3)12-7-5(10)13-15-14-7/h1-2H.
What are the key properties of 4-chloro-N-(3,5-dichloro-2-pyridinyl)dithiazol-5-imine?
4-chloro-N-(3,5-dichloro-2-pyridinyl)dithiazol-5-imine has a molecular weight of 298.61 g/mol, XLogP of 3.79, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(3,5-dichloro-2-pyridinyl)dithiazol-5-imine is sourced from PubChem (CID 86278907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).