About 1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methoxypropane-1,3-diol
1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methoxypropane-1,3-diol (PubChem CID 86279003) has the molecular formula C18H30O4
and a molecular weight of 310.43 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methoxypropane-1,3-diol.
Molecular Properties
| Compound Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methoxypropane-1,3-diol |
| PubChem CID | 86279003 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methoxypropane-1,3-diol |
| SMILES | COC(O)CC(O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H30O4/c1-17(2,3)12-8-11(14(19)10-15(20)22-7)9-13(16(12)21)18(4,5)6/h8-9,14-15,19-21H,10H2,1-7H3 |
| InChIKey | GLWVCXZSIHRHNC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methoxypropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methoxypropane-1,3-diol?
The IUPAC name of 1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methoxypropane-1,3-diol (CID 86279003) is 1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methoxypropane-1,3-diol.
What is the SMILES notation for 1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methoxypropane-1,3-diol?
The canonical SMILES for 1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methoxypropane-1,3-diol is COC(O)CC(O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methoxypropane-1,3-diol?
The InChIKey is GLWVCXZSIHRHNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O4/c1-17(2,3)12-8-11(14(19)10-15(20)22-7)9-13(16(12)21)18(4,5)6/h8-9,14-15,19-21H,10H2,1-7H3.
What are the key properties of 1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methoxypropane-1,3-diol?
1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methoxypropane-1,3-diol has a molecular weight of 310.43 g/mol, XLogP of 3.38, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methoxypropane-1,3-diol is sourced from PubChem (CID 86279003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).