C13H13N5O2S — CID 8627910
(4,6-diamino-1,3,5-triazin-2-yl)methyl (E)-3-phenylsulfanylprop-2-enoate (PubChem CID 8627910) has the molecular formula C13H13N5O2S and a molecular weight of 303.35 g/mol. Its IUPAC name is (4,6-diamino-1,3,5-triazin-2-yl)methyl (E)-3-phenylsulfanylprop-2-enoate.
| Compound Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl (E)-3-phenylsulfanylprop-2-enoate |
|---|---|
| PubChem CID | 8627910 |
| Molecular Formula | C13H13N5O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl (E)-3-phenylsulfanylprop-2-enoate |
| SMILES | Nc1nc(N)nc(COC(=O)/C=C/Sc2ccccc2)n1 |
| InChI | InChI=1S/C13H13N5O2S/c14-12-16-10(17-13(15)18-12)8-20-11(19)6-7-21-9-4-2-1-3-5-9/h1-7H,8H2,(H4,14,15,16,17,18)/b7-6+ |
| InChIKey | OGTVCDREAKYHLI-VOTSOKGWSA-N |
| XLogP | 1.39 |
| TPSA | 117.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|