C17H19N3O3S — CID 86279216
ethyl (2S,9R)-11-methyl-7-oxo-9-thiophen-2-yl-3,6,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),10-diene-10-carboxylate (PubChem CID 86279216) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is ethyl (2S,9R)-11-methyl-7-oxo-9-thiophen-2-yl-3,6,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),10-diene-10-carboxylate.
| Compound Name | ethyl (2S,9R)-11-methyl-7-oxo-9-thiophen-2-yl-3,6,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),10-diene-10-carboxylate |
|---|---|
| PubChem CID | 86279216 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | ethyl (2S,9R)-11-methyl-7-oxo-9-thiophen-2-yl-3,6,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),10-diene-10-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC2=C(C(=O)N3CCN[C@H]23)[C@H]1c1cccs1 |
| InChI | InChI=1S/C17H19N3O3S/c1-3-23-17(22)11-9(2)19-14-13(12(11)10-5-4-8-24-10)16(21)20-7-6-18-15(14)20/h4-5,8,12,15,18-19H,3,6-7H2,1-2H3/t12-,15-/m0/s1 |
| InChIKey | ZDGGLZLCHXAECR-WFASDCNBSA-N |
| XLogP | 1.30 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |