C25H26FN7OS — CID 86279245
(5Z)-5-[[3-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-b]pyridazin-6-yl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one (PubChem CID 86279245) has the molecular formula C25H26FN7OS and a molecular weight of 491.60 g/mol. Its IUPAC name is (5Z)-5-[[3-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-b]pyridazin-6-yl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[3-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-b]pyridazin-6-yl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 86279245 |
| Molecular Formula | C25H26FN7OS |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | (5Z)-5-[[3-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-b]pyridazin-6-yl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one |
| SMILES | CN1CCN(c2ccc(-c3cnc4ccc(/C=C5\SC(N6CCCC6)=NC5=O)nn34)cc2F)CC1 |
| InChI | InChI=1S/C25H26FN7OS/c1-30-10-12-31(13-11-30)20-6-4-17(14-19(20)26)21-16-27-23-7-5-18(29-33(21)23)15-22-24(34)28-25(35-22)32-8-2-3-9-32/h4-7,14-16H,2-3,8-13H2,1H3/b22-15- |
| InChIKey | DZEPATYEQUESHF-JCMHNJIXSA-N |
| XLogP | 3.35 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|