C23H26N3O7P — CID 86279464
3-benzoyl-1-[(3S,5S)-3-diethoxyphosphoryl-2-methyl-1,2-oxazolidin-5-yl]quinazoline-2,4-dione (PubChem CID 86279464) has the molecular formula C23H26N3O7P and a molecular weight of 487.45 g/mol. Its IUPAC name is 3-benzoyl-1-[(3S,5S)-3-diethoxyphosphoryl-2-methyl-1,2-oxazolidin-5-yl]quinazoline-2,4-dione.
| Compound Name | 3-benzoyl-1-[(3S,5S)-3-diethoxyphosphoryl-2-methyl-1,2-oxazolidin-5-yl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 86279464 |
| Molecular Formula | C23H26N3O7P |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 3-benzoyl-1-[(3S,5S)-3-diethoxyphosphoryl-2-methyl-1,2-oxazolidin-5-yl]quinazoline-2,4-dione |
| SMILES | CCOP(=O)(OCC)[C@H]1C[C@@H](n2c(=O)n(C(=O)c3ccccc3)c(=O)c3ccccc32)ON1C |
| InChI | InChI=1S/C23H26N3O7P/c1-4-31-34(30,32-5-2)20-15-19(33-24(20)3)25-18-14-10-9-13-17(18)22(28)26(23(25)29)21(27)16-11-7-6-8-12-16/h6-14,19-20H,4-5,15H2,1-3H3/t19-,20-/m0/s1 |
| InChIKey | CQEVETXPUOBSTE-PMACEKPBSA-N |
| XLogP | 3.21 |
| TPSA | 109.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|