C22H26N8O2 — CID 86279585
trans-(1R,3R)-3-[[3-[4-[1-(2-ethoxyethyl)pyrazol-4-yl]phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentan-1-ol (PubChem CID 86279585) has the molecular formula C22H26N8O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is trans-(1R,3R)-3-[[3-[4-[1-(2-ethoxyethyl)pyrazol-4-yl]phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentan-1-ol.
| Compound Name | trans-(1R,3R)-3-[[3-[4-[1-(2-ethoxyethyl)pyrazol-4-yl]phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 86279585 |
| Molecular Formula | C22H26N8O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | trans-(1R,3R)-3-[[3-[4-[1-(2-ethoxyethyl)pyrazol-4-yl]phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentan-1-ol |
| SMILES | CCOCCn1cc(-c2ccc(-n3nnc4cnc(N[C@@H]5CC[C@@H](O)C5)nc43)cc2)cn1 |
| InChI | InChI=1S/C22H26N8O2/c1-2-32-10-9-29-14-16(12-24-29)15-3-6-18(7-4-15)30-21-20(27-28-30)13-23-22(26-21)25-17-5-8-19(31)11-17/h3-4,6-7,12-14,17,19,31H,2,5,8-11H2,1H3,(H,23,25,26)/t17-,19-/m1/s1 |
| InChIKey | POUJPZAZJAAMMV-IEBWSBKVSA-N |
| XLogP | 2.44 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|