C26H34N8O — CID 86279754
4-[[5-(3,3,4-trimethylpiperazin-1-yl)-2-pyridinyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-10-one (PubChem CID 86279754) has the molecular formula C26H34N8O and a molecular weight of 474.61 g/mol. Its IUPAC name is 4-[[5-(3,3,4-trimethylpiperazin-1-yl)-2-pyridinyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-10-one.
| Compound Name | 4-[[5-(3,3,4-trimethylpiperazin-1-yl)-2-pyridinyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-10-one |
|---|---|
| PubChem CID | 86279754 |
| Molecular Formula | C26H34N8O |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | 4-[[5-(3,3,4-trimethylpiperazin-1-yl)-2-pyridinyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-10-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4cc5n(c4n3)C3(CCCCC3)CNC5=O)nc2)CC1(C)C |
| InChI | InChI=1S/C26H34N8O/c1-25(2)17-33(12-11-32(25)3)19-7-8-21(27-15-19)30-24-28-14-18-13-20-23(35)29-16-26(9-5-4-6-10-26)34(20)22(18)31-24/h7-8,13-15H,4-6,9-12,16-17H2,1-3H3,(H,29,35)(H,27,28,30,31) |
| InChIKey | LDJNLOZYHRVQME-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |