C22H28N2O6 — CID 86280037
2-amino-N-[(2R,3S,6S,7R,8R)-8-hex-5-ynyl-7-hydroxy-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-3-yl]benzamide (PubChem CID 86280037) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is 2-amino-N-[(2R,3S,6S,7R,8R)-8-hex-5-ynyl-7-hydroxy-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-3-yl]benzamide.
| Compound Name | 2-amino-N-[(2R,3S,6S,7R,8R)-8-hex-5-ynyl-7-hydroxy-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-3-yl]benzamide |
|---|---|
| PubChem CID | 86280037 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 2-amino-N-[(2R,3S,6S,7R,8R)-8-hex-5-ynyl-7-hydroxy-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-3-yl]benzamide |
| SMILES | C#CCCCC[C@H]1C(=O)O[C@H](C)[C@H](NC(=O)c2ccccc2N)C(=O)O[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C22H28N2O6/c1-4-5-6-7-11-16-19(25)14(3)30-22(28)18(13(2)29-21(16)27)24-20(26)15-10-8-9-12-17(15)23/h1,8-10,12-14,16,18-19,25H,5-7,11,23H2,2-3H3,(H,24,26)/t13-,14+,16-,18+,19+/m1/s1 |
| InChIKey | VCTGSULSPLQWFT-KZYWPTACSA-N |
| XLogP | 1.41 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|