About 4-bromo-1-methyl-3,6-dihydro-2H-pyridine;hydrobromide
4-bromo-1-methyl-3,6-dihydro-2H-pyridine;hydrobromide (PubChem CID 86280179) has the molecular formula C6H11Br2N
and a molecular weight of 256.97 g/mol. Its IUPAC name is 4-bromo-1-methyl-3,6-dihydro-2H-pyridine;hydrobromide.
Molecular Properties
| Compound Name | 4-bromo-1-methyl-3,6-dihydro-2H-pyridine;hydrobromide |
| PubChem CID | 86280179 |
| Molecular Formula | C6H11Br2N |
| Molecular Weight | 256.97 g/mol |
| Exact Mass | 254.93 |
| IUPAC Name | 4-bromo-1-methyl-3,6-dihydro-2H-pyridine;hydrobromide |
| SMILES | Br.CN1CC=C(Br)CC1 |
| InChI | InChI=1S/C6H10BrN.BrH/c1-8-4-2-6(7)3-5-8;/h2H,3-5H2,1H3;1H |
| InChIKey | SWUKRCXLXXYOET-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.97 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-1-methyl-3,6-dihydro-2H-pyridine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-methyl-3,6-dihydro-2H-pyridine;hydrobromide?
The IUPAC name of 4-bromo-1-methyl-3,6-dihydro-2H-pyridine;hydrobromide (CID 86280179) is 4-bromo-1-methyl-3,6-dihydro-2H-pyridine;hydrobromide.
What is the SMILES notation for 4-bromo-1-methyl-3,6-dihydro-2H-pyridine;hydrobromide?
The canonical SMILES for 4-bromo-1-methyl-3,6-dihydro-2H-pyridine;hydrobromide is Br.CN1CC=C(Br)CC1.
What is the InChIKey of 4-bromo-1-methyl-3,6-dihydro-2H-pyridine;hydrobromide?
The InChIKey is SWUKRCXLXXYOET-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10BrN.BrH/c1-8-4-2-6(7)3-5-8;/h2H,3-5H2,1H3;1H.
What are the key properties of 4-bromo-1-methyl-3,6-dihydro-2H-pyridine;hydrobromide?
4-bromo-1-methyl-3,6-dihydro-2H-pyridine;hydrobromide has a molecular weight of 256.97 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-methyl-3,6-dihydro-2H-pyridine;hydrobromide is sourced from PubChem (CID 86280179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).