About 2-(cyclopentylamino)-3,7-diethylthieno[3,2-d]pyrimidin-4-one
2-(cyclopentylamino)-3,7-diethylthieno[3,2-d]pyrimidin-4-one (PubChem CID 86280445) has the molecular formula C15H21N3OS
and a molecular weight of 291.42 g/mol. Its IUPAC name is 2-(cyclopentylamino)-3,7-diethylthieno[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-(cyclopentylamino)-3,7-diethylthieno[3,2-d]pyrimidin-4-one |
| PubChem CID | 86280445 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-(cyclopentylamino)-3,7-diethylthieno[3,2-d]pyrimidin-4-one |
| SMILES | CCc1csc2c(=O)n(CC)c(NC3CCCC3)nc12 |
| InChI | InChI=1S/C15H21N3OS/c1-3-10-9-20-13-12(10)17-15(18(4-2)14(13)19)16-11-7-5-6-8-11/h9,11H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | BWSIWBJRZRFBBB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(cyclopentylamino)-3,7-diethylthieno[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopentylamino)-3,7-diethylthieno[3,2-d]pyrimidin-4-one?
The IUPAC name of 2-(cyclopentylamino)-3,7-diethylthieno[3,2-d]pyrimidin-4-one (CID 86280445) is 2-(cyclopentylamino)-3,7-diethylthieno[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 2-(cyclopentylamino)-3,7-diethylthieno[3,2-d]pyrimidin-4-one?
The canonical SMILES for 2-(cyclopentylamino)-3,7-diethylthieno[3,2-d]pyrimidin-4-one is CCc1csc2c(=O)n(CC)c(NC3CCCC3)nc12.
What is the InChIKey of 2-(cyclopentylamino)-3,7-diethylthieno[3,2-d]pyrimidin-4-one?
The InChIKey is BWSIWBJRZRFBBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3OS/c1-3-10-9-20-13-12(10)17-15(18(4-2)14(13)19)16-11-7-5-6-8-11/h9,11H,3-8H2,1-2H3,(H,16,17).
What are the key properties of 2-(cyclopentylamino)-3,7-diethylthieno[3,2-d]pyrimidin-4-one?
2-(cyclopentylamino)-3,7-diethylthieno[3,2-d]pyrimidin-4-one has a molecular weight of 291.42 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopentylamino)-3,7-diethylthieno[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 86280445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).