C20H21NO4S — CID 8628053
[(2R)-1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-1-oxopropan-2-yl] (E)-3-phenylsulfanylprop-2-enoate (PubChem CID 8628053) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is [(2R)-1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-1-oxopropan-2-yl] (E)-3-phenylsulfanylprop-2-enoate.
| Compound Name | [(2R)-1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-1-oxopropan-2-yl] (E)-3-phenylsulfanylprop-2-enoate |
|---|---|
| PubChem CID | 8628053 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | [(2R)-1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-1-oxopropan-2-yl] (E)-3-phenylsulfanylprop-2-enoate |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)/C=C/Sc2ccccc2)c1C |
| InChI | InChI=1S/C20H21NO4S/c1-12-18(14(3)22)13(2)21-19(12)20(24)15(4)25-17(23)10-11-26-16-8-6-5-7-9-16/h5-11,15,21H,1-4H3/b11-10+/t15-/m1/s1 |
| InChIKey | HFMMWTBNVDZPCB-AUECHBEKSA-N |
| XLogP | 4.25 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|