C27H31NO5 — CID 86280552
methyl (6S,6aS,10R,10aS)-10-[(2E)-2-[(4S)-4-hydroxy-2-oxooxolan-3-ylidene]ethyl]-6,10a-dimethyl-9-methylidene-5,6a,7,8,10,11-hexahydrobenzo[b]carbazole-6-carboxylate (PubChem CID 86280552) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is methyl (6S,6aS,10R,10aS)-10-[(2E)-2-[(4S)-4-hydroxy-2-oxooxolan-3-ylidene]ethyl]-6,10a-dimethyl-9-methylidene-5,6a,7,8,10,11-hexahydrobenzo[b]carbazole-6-carboxylate.
| Compound Name | methyl (6S,6aS,10R,10aS)-10-[(2E)-2-[(4S)-4-hydroxy-2-oxooxolan-3-ylidene]ethyl]-6,10a-dimethyl-9-methylidene-5,6a,7,8,10,11-hexahydrobenzo[b]carbazole-6-carboxylate |
|---|---|
| PubChem CID | 86280552 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | methyl (6S,6aS,10R,10aS)-10-[(2E)-2-[(4S)-4-hydroxy-2-oxooxolan-3-ylidene]ethyl]-6,10a-dimethyl-9-methylidene-5,6a,7,8,10,11-hexahydrobenzo[b]carbazole-6-carboxylate |
| SMILES | C=C1CC[C@H]2[C@@](C)(Cc3c([nH]c4ccccc34)[C@@]2(C)C(=O)OC)[C@@H]1C/C=C1/C(=O)OC[C@H]1O |
| InChI | InChI=1S/C27H31NO5/c1-15-9-12-22-26(2,19(15)11-10-17-21(29)14-33-24(17)30)13-18-16-7-5-6-8-20(16)28-23(18)27(22,3)25(31)32-4/h5-8,10,19,21-22,28-29H,1,9,11-14H2,2-4H3/b17-10+/t19-,21-,22+,26+,27+/m1/s1 |
| InChIKey | XUFJAQSLKFJTHB-GLBVDRPWSA-N |
| XLogP | 3.98 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|