C21H28BFN4O4 — CID 86280847
[4-[[[(3R)-2,2-dimethylpentan-3-yl]-(4,6-dimethylpyrimidine-2-carbonyl)amino]carbamoyl]-3-fluorophenyl]boronic acid (PubChem CID 86280847) has the molecular formula C21H28BFN4O4 and a molecular weight of 430.29 g/mol. Its IUPAC name is [4-[[[(3R)-2,2-dimethylpentan-3-yl]-(4,6-dimethylpyrimidine-2-carbonyl)amino]carbamoyl]-3-fluorophenyl]boronic acid.
| Compound Name | [4-[[[(3R)-2,2-dimethylpentan-3-yl]-(4,6-dimethylpyrimidine-2-carbonyl)amino]carbamoyl]-3-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 86280847 |
| Molecular Formula | C21H28BFN4O4 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | [4-[[[(3R)-2,2-dimethylpentan-3-yl]-(4,6-dimethylpyrimidine-2-carbonyl)amino]carbamoyl]-3-fluorophenyl]boronic acid |
| SMILES | CC[C@@H](N(NC(=O)c1ccc(B(O)O)cc1F)C(=O)c1nc(C)cc(C)n1)C(C)(C)C |
| InChI | InChI=1S/C21H28BFN4O4/c1-7-17(21(4,5)6)27(20(29)18-24-12(2)10-13(3)25-18)26-19(28)15-9-8-14(22(30)31)11-16(15)23/h8-11,17,30-31H,7H2,1-6H3,(H,26,28)/t17-/m1/s1 |
| InChIKey | HBBFBSQAXSTEKW-QGZVFWFLSA-N |
| XLogP | 1.52 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|