C28H25N3O2 — CID 86281080
[2-cyclopropyl-6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-benzimidazol-4-yl]-diphenylmethanol (PubChem CID 86281080) has the molecular formula C28H25N3O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is [2-cyclopropyl-6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-benzimidazol-4-yl]-diphenylmethanol.
| Compound Name | [2-cyclopropyl-6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-benzimidazol-4-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 86281080 |
| Molecular Formula | C28H25N3O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | [2-cyclopropyl-6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-benzimidazol-4-yl]-diphenylmethanol |
| SMILES | Cc1noc(C)c1-c1cc(C(O)(c2ccccc2)c2ccccc2)c2nc(C3CC3)[nH]c2c1 |
| InChI | InChI=1S/C28H25N3O2/c1-17-25(18(2)33-31-17)20-15-23(26-24(16-20)29-27(30-26)19-13-14-19)28(32,21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-12,15-16,19,32H,13-14H2,1-2H3,(H,29,30) |
| InChIKey | VCOPOFJUYXUWQK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|