C29H41BF2N2O5 — CID 86281130
3-[2-(difluoromethoxy)-4-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylhexan-3-yl]amino]carbamoyl]-3-methylphenyl]propylboronic acid (PubChem CID 86281130) has the molecular formula C29H41BF2N2O5 and a molecular weight of 546.46 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)-4-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylhexan-3-yl]amino]carbamoyl]-3-methylphenyl]propylboronic acid.
| Compound Name | 3-[2-(difluoromethoxy)-4-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylhexan-3-yl]amino]carbamoyl]-3-methylphenyl]propylboronic acid |
|---|---|
| PubChem CID | 86281130 |
| Molecular Formula | C29H41BF2N2O5 |
| Molecular Weight | 546.46 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | 3-[2-(difluoromethoxy)-4-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylhexan-3-yl]amino]carbamoyl]-3-methylphenyl]propylboronic acid |
| SMILES | CCC[C@@H](N(NC(=O)c1ccc(CCCB(O)O)c(OC(F)F)c1C)C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C29H41BF2N2O5/c1-8-10-24(29(5,6)7)34(27(36)22-16-18(2)15-19(3)17-22)33-26(35)23-13-12-21(11-9-14-30(37)38)25(20(23)4)39-28(31)32/h12-13,15-17,24,28,37-38H,8-11,14H2,1-7H3,(H,33,35)/t24-/m1/s1 |
| InChIKey | GGBYPUNSYYTOMM-XMMPIXPASA-N |
| XLogP | 5.62 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|