C25H20Br2F3NO3 — CID 86281252
US11407721, Example 8 (PubChem CID 86281252) has the molecular formula C25H20Br2F3NO3 and a molecular weight of 599.20 g/mol. Its IUPAC name is (2R,5S,6R)-5,6-bis(4-bromophenyl)-4-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]morpholin-3-one.
| Compound Name | US11407721, Example 8 |
|---|---|
| PubChem CID | 86281252 |
| Molecular Formula | C25H20Br2F3NO3 |
| Molecular Weight | 599.20 g/mol |
| Exact Mass | 598.97 |
| IUPAC Name | (2R,5S,6R)-5,6-bis(4-bromophenyl)-4-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]morpholin-3-one |
| SMILES | CN1[C@H]([C@H](O[C@@H](C1=O)CC2=CC=C(C=C2)OC(F)(F)F)C3=CC=C(C=C3)Br)C4=CC=C(C=C4)Br |
| InChI | InChI=1S/C25H20Br2F3NO3/c1-31-22(16-4-8-18(26)9-5-16)23(17-6-10-19(27)11-7-17)33-21(24(31)32)14-15-2-12-20(13-3-15)34-25(28,29)30/h2-13,21-23H,14H2,1H3/t21-,22+,23-/m1/s1 |
| InChIKey | HYNGBJAFVPKRRJ-XPWALMASSA-N |
| XLogP | 7.00 |
| TPSA | 38.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | 673 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.20 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |