C23H30BFN2O5 — CID 86281267
[3-[2,2-dimethylpentan-3-yl-[(3-methoxy-2-methylbenzoyl)amino]carbamoyl]-4-fluorophenyl]boronic acid (PubChem CID 86281267) has the molecular formula C23H30BFN2O5 and a molecular weight of 444.31 g/mol. Its IUPAC name is [3-[2,2-dimethylpentan-3-yl-[(3-methoxy-2-methylbenzoyl)amino]carbamoyl]-4-fluorophenyl]boronic acid.
| Compound Name | [3-[2,2-dimethylpentan-3-yl-[(3-methoxy-2-methylbenzoyl)amino]carbamoyl]-4-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 86281267 |
| Molecular Formula | C23H30BFN2O5 |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | [3-[2,2-dimethylpentan-3-yl-[(3-methoxy-2-methylbenzoyl)amino]carbamoyl]-4-fluorophenyl]boronic acid |
| SMILES | CCC(N(NC(=O)c1cccc(OC)c1C)C(=O)c1cc(B(O)O)ccc1F)C(C)(C)C |
| InChI | InChI=1S/C23H30BFN2O5/c1-7-20(23(3,4)5)27(22(29)17-13-15(24(30)31)11-12-18(17)25)26-21(28)16-9-8-10-19(32-6)14(16)2/h8-13,20,30-31H,7H2,1-6H3,(H,26,28) |
| InChIKey | MGEJEGFDWYZCEW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|