C19H23BN4O4 — CID 86281660
N-tert-butyl-N'-(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)-4,6-dimethylpyrimidine-2-carbohydrazide (PubChem CID 86281660) has the molecular formula C19H23BN4O4 and a molecular weight of 382.23 g/mol. Its IUPAC name is N-tert-butyl-N'-(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)-4,6-dimethylpyrimidine-2-carbohydrazide.
| Compound Name | N-tert-butyl-N'-(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)-4,6-dimethylpyrimidine-2-carbohydrazide |
|---|---|
| PubChem CID | 86281660 |
| Molecular Formula | C19H23BN4O4 |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-tert-butyl-N'-(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)-4,6-dimethylpyrimidine-2-carbohydrazide |
| SMILES | Cc1cc(C)nc(C(=O)N(NC(=O)c2ccc3c(c2)B(O)OC3)C(C)(C)C)n1 |
| InChI | InChI=1S/C19H23BN4O4/c1-11-8-12(2)22-16(21-11)18(26)24(19(3,4)5)23-17(25)13-6-7-14-10-28-20(27)15(14)9-13/h6-9,27H,10H2,1-5H3,(H,23,25) |
| InChIKey | MJJCODSJJXFGLQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|