C22H26BFN2O4 — CID 86281799
N'-benzoyl-N'-[(3R)-2,2-dimethylpentan-3-yl]-7-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carbohydrazide (PubChem CID 86281799) has the molecular formula C22H26BFN2O4 and a molecular weight of 412.27 g/mol. Its IUPAC name is N'-benzoyl-N'-[(3R)-2,2-dimethylpentan-3-yl]-7-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carbohydrazide.
| Compound Name | N'-benzoyl-N'-[(3R)-2,2-dimethylpentan-3-yl]-7-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carbohydrazide |
|---|---|
| PubChem CID | 86281799 |
| Molecular Formula | C22H26BFN2O4 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N'-benzoyl-N'-[(3R)-2,2-dimethylpentan-3-yl]-7-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carbohydrazide |
| SMILES | CC[C@@H](N(NC(=O)c1ccc2c(c1F)B(O)OC2)C(=O)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H26BFN2O4/c1-5-17(22(2,3)4)26(21(28)14-9-7-6-8-10-14)25-20(27)16-12-11-15-13-30-23(29)18(15)19(16)24/h6-12,17,29H,5,13H2,1-4H3,(H,25,27)/t17-/m1/s1 |
| InChIKey | DPCFZONBWDGAMF-QGZVFWFLSA-N |
| XLogP | 2.66 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|