C13F26O7 — CID 86282027
2,2,4,4,5,5,7,7,8,8,10,10,11,11,13,13,14,14,16,16,17,17,19,19,20,20-hexacosafluoro-1,3,6,9,12,15,18-heptaoxacycloicosane (PubChem CID 86282027) has the molecular formula C13F26O7 and a molecular weight of 762.08 g/mol. Its IUPAC name is 2,2,4,4,5,5,7,7,8,8,10,10,11,11,13,13,14,14,16,16,17,17,19,19,20,20-hexacosafluoro-1,3,6,9,12,15,18-heptaoxacycloicosane.
| Compound Name | 2,2,4,4,5,5,7,7,8,8,10,10,11,11,13,13,14,14,16,16,17,17,19,19,20,20-hexacosafluoro-1,3,6,9,12,15,18-heptaoxacycloicosane |
|---|---|
| PubChem CID | 86282027 |
| Molecular Formula | C13F26O7 |
| Molecular Weight | 762.08 g/mol |
| Exact Mass | 761.92 |
| IUPAC Name | 2,2,4,4,5,5,7,7,8,8,10,10,11,11,13,13,14,14,16,16,17,17,19,19,20,20-hexacosafluoro-1,3,6,9,12,15,18-heptaoxacycloicosane |
| SMILES | FC1(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)O1 |
| InChI | InChI=1S/C13F26O7/c14-1(15)3(18,19)41-5(22,23)7(26,27)43-9(30,31)11(34,35)45-13(38,39)46-12(36,37)10(32,33)44-8(28,29)6(24,25)42-4(20,21)2(16,17)40-1 |
| InChIKey | PQDXWGFVLJRUFL-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.08 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|