C20H23N3O8S2 — CID 86282184
(4S,14S)-9,9-dimethyl-2,7,11,16-tetraoxo-6,12-dithia-3,15,21-triazabicyclo[15.3.1]henicosa-1(21),17,19-triene-4,14-dicarboxylic acid (PubChem CID 86282184) has the molecular formula C20H23N3O8S2 and a molecular weight of 497.55 g/mol. Its IUPAC name is (4S,14S)-9,9-dimethyl-2,7,11,16-tetraoxo-6,12-dithia-3,15,21-triazabicyclo[15.3.1]henicosa-1(21),17,19-triene-4,14-dicarboxylic acid.
| Compound Name | (4S,14S)-9,9-dimethyl-2,7,11,16-tetraoxo-6,12-dithia-3,15,21-triazabicyclo[15.3.1]henicosa-1(21),17,19-triene-4,14-dicarboxylic acid |
|---|---|
| PubChem CID | 86282184 |
| Molecular Formula | C20H23N3O8S2 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | (4S,14S)-9,9-dimethyl-2,7,11,16-tetraoxo-6,12-dithia-3,15,21-triazabicyclo[15.3.1]henicosa-1(21),17,19-triene-4,14-dicarboxylic acid |
| SMILES | CC1(C)CC(=O)SC[C@H](C(=O)O)NC(=O)c2cccc(n2)C(=O)N[C@@H](C(=O)O)CSC(=O)C1 |
| InChI | InChI=1S/C20H23N3O8S2/c1-20(2)6-14(24)32-8-12(18(28)29)22-16(26)10-4-3-5-11(21-10)17(27)23-13(19(30)31)9-33-15(25)7-20/h3-5,12-13H,6-9H2,1-2H3,(H,22,26)(H,23,27)(H,28,29)(H,30,31)/t12-,13-/m1/s1 |
| InChIKey | KYAFWSADXLOANC-CHWSQXEVSA-N |
| XLogP | 0.79 |
| TPSA | 179.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|