About [(E)-non-3-enyl] N-[(3S)-2-oxoazetidin-3-yl]carbamate
[(E)-non-3-enyl] N-[(3S)-2-oxoazetidin-3-yl]carbamate (PubChem CID 86282351) has the molecular formula C13H22N2O3
and a molecular weight of 254.33 g/mol. Its IUPAC name is [(E)-non-3-enyl] N-[(3S)-2-oxoazetidin-3-yl]carbamate.
Molecular Properties
| Compound Name | [(E)-non-3-enyl] N-[(3S)-2-oxoazetidin-3-yl]carbamate |
| PubChem CID | 86282351 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | [(E)-non-3-enyl] N-[(3S)-2-oxoazetidin-3-yl]carbamate |
| SMILES | CCCCC/C=C/CCOC(=O)N[C@H]1CNC1=O |
| InChI | InChI=1S/C13H22N2O3/c1-2-3-4-5-6-7-8-9-18-13(17)15-11-10-14-12(11)16/h6-7,11H,2-5,8-10H2,1H3,(H,14,16)(H,15,17)/b7-6+/t11-/m0/s1 |
| InChIKey | WQHCIBOOQMPGMI-MLRMMBSGSA-N |
| XLogP | 1.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-non-3-enyl] N-[(3S)-2-oxoazetidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-non-3-enyl] N-[(3S)-2-oxoazetidin-3-yl]carbamate?
The IUPAC name of [(E)-non-3-enyl] N-[(3S)-2-oxoazetidin-3-yl]carbamate (CID 86282351) is [(E)-non-3-enyl] N-[(3S)-2-oxoazetidin-3-yl]carbamate.
What is the SMILES notation for [(E)-non-3-enyl] N-[(3S)-2-oxoazetidin-3-yl]carbamate?
The canonical SMILES for [(E)-non-3-enyl] N-[(3S)-2-oxoazetidin-3-yl]carbamate is CCCCC/C=C/CCOC(=O)N[C@H]1CNC1=O.
What is the InChIKey of [(E)-non-3-enyl] N-[(3S)-2-oxoazetidin-3-yl]carbamate?
The InChIKey is WQHCIBOOQMPGMI-MLRMMBSGSA-N. The full InChI is InChI=1S/C13H22N2O3/c1-2-3-4-5-6-7-8-9-18-13(17)15-11-10-14-12(11)16/h6-7,11H,2-5,8-10H2,1H3,(H,14,16)(H,15,17)/b7-6+/t11-/m0/s1.
What are the key properties of [(E)-non-3-enyl] N-[(3S)-2-oxoazetidin-3-yl]carbamate?
[(E)-non-3-enyl] N-[(3S)-2-oxoazetidin-3-yl]carbamate has a molecular weight of 254.33 g/mol, XLogP of 1.74, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-non-3-enyl] N-[(3S)-2-oxoazetidin-3-yl]carbamate is sourced from PubChem (CID 86282351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).