About 1-butyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea
1-butyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea (PubChem CID 8628245) has the molecular formula C13H26N4S2
and a molecular weight of 302.51 g/mol. Its IUPAC name is 1-butyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea.
Molecular Properties
| Compound Name | 1-butyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea |
| PubChem CID | 8628245 |
| Molecular Formula | C13H26N4S2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-butyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea |
| SMILES | CCCCNC(=S)NNC(=S)N[C@@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C13H26N4S2/c1-3-4-9-14-12(18)16-17-13(19)15-11-8-6-5-7-10(11)2/h10-11H,3-9H2,1-2H3,(H2,14,16,18)(H2,15,17,19)/t10-,11-/m1/s1 |
| InChIKey | QTRPAJXIXSOLSB-GHMZBOCLSA-N |
| XLogP | 2.21 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea?
The IUPAC name of 1-butyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea (CID 8628245) is 1-butyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea.
What is the SMILES notation for 1-butyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea?
The canonical SMILES for 1-butyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea is CCCCNC(=S)NNC(=S)N[C@@H]1CCCC[C@H]1C.
What is the InChIKey of 1-butyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea?
The InChIKey is QTRPAJXIXSOLSB-GHMZBOCLSA-N. The full InChI is InChI=1S/C13H26N4S2/c1-3-4-9-14-12(18)16-17-13(19)15-11-8-6-5-7-10(11)2/h10-11H,3-9H2,1-2H3,(H2,14,16,18)(H2,15,17,19)/t10-,11-/m1/s1.
What are the key properties of 1-butyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea?
1-butyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea has a molecular weight of 302.51 g/mol, XLogP of 2.21, 4 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea is sourced from PubChem (CID 8628245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).