C22H19N3O8S2 — CID 86282459
(4S,16S)-10-methyl-2,7,13,18-tetraoxo-6,14-dithia-3,17,23-triazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-4,16-dicarboxylic acid (PubChem CID 86282459) has the molecular formula C22H19N3O8S2 and a molecular weight of 517.54 g/mol. Its IUPAC name is (4S,16S)-10-methyl-2,7,13,18-tetraoxo-6,14-dithia-3,17,23-triazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-4,16-dicarboxylic acid.
| Compound Name | (4S,16S)-10-methyl-2,7,13,18-tetraoxo-6,14-dithia-3,17,23-triazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-4,16-dicarboxylic acid |
|---|---|
| PubChem CID | 86282459 |
| Molecular Formula | C22H19N3O8S2 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | (4S,16S)-10-methyl-2,7,13,18-tetraoxo-6,14-dithia-3,17,23-triazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-4,16-dicarboxylic acid |
| SMILES | Cc1cc2cc(c1)C(=O)SC[C@H](C(=O)O)NC(=O)c1cccc(n1)C(=O)N[C@@H](C(=O)O)CSC2=O |
| InChI | InChI=1S/C22H19N3O8S2/c1-10-5-11-7-12(6-10)22(33)35-9-16(20(30)31)25-18(27)14-4-2-3-13(23-14)17(26)24-15(19(28)29)8-34-21(11)32/h2-7,15-16H,8-9H2,1H3,(H,24,26)(H,25,27)(H,28,29)(H,30,31)/t15-,16-/m1/s1 |
| InChIKey | HAHBHUKYPREUHH-HZPDHXFCSA-N |
| XLogP | 1.22 |
| TPSA | 179.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|