About [3-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid
[3-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid (PubChem CID 86282477) has the molecular formula C22H28BFN2O5
and a molecular weight of 430.29 g/mol. Its IUPAC name is [3-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid.
Molecular Properties
| Compound Name | [3-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid |
| PubChem CID | 86282477 |
| Molecular Formula | C22H28BFN2O5 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | [3-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid |
| SMILES | COCc1ccc(C(=O)NN(C(=O)c2cc(C)cc(C)c2)C(C)(C)C)c(F)c1B(O)O |
| InChI | InChI=1S/C22H28BFN2O5/c1-13-9-14(2)11-16(10-13)21(28)26(22(3,4)5)25-20(27)17-8-7-15(12-31-6)18(19(17)24)23(29)30/h7-11,29-30H,12H2,1-6H3,(H,25,27) |
| InChIKey | UTMGDLKESTWVTF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid?
The IUPAC name of [3-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid (CID 86282477) is [3-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid.
What is the SMILES notation for [3-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid?
The canonical SMILES for [3-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid is COCc1ccc(C(=O)NN(C(=O)c2cc(C)cc(C)c2)C(C)(C)C)c(F)c1B(O)O.
What is the InChIKey of [3-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid?
The InChIKey is UTMGDLKESTWVTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28BFN2O5/c1-13-9-14(2)11-16(10-13)21(28)26(22(3,4)5)25-20(27)17-8-7-15(12-31-6)18(19(17)24)23(29)30/h7-11,29-30H,12H2,1-6H3,(H,25,27).
What are the key properties of [3-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid?
[3-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid has a molecular weight of 430.29 g/mol, XLogP of 1.85, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid is sourced from PubChem (CID 86282477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).