C28H30BFN2O4 — CID 86282478
N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethyl-1-phenylpropyl)-4-fluoro-1-hydroxy-3H-2,1-benzoxaborole-5-carbohydrazide (PubChem CID 86282478) has the molecular formula C28H30BFN2O4 and a molecular weight of 488.37 g/mol. Its IUPAC name is N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethyl-1-phenylpropyl)-4-fluoro-1-hydroxy-3H-2,1-benzoxaborole-5-carbohydrazide.
| Compound Name | N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethyl-1-phenylpropyl)-4-fluoro-1-hydroxy-3H-2,1-benzoxaborole-5-carbohydrazide |
|---|---|
| PubChem CID | 86282478 |
| Molecular Formula | C28H30BFN2O4 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethyl-1-phenylpropyl)-4-fluoro-1-hydroxy-3H-2,1-benzoxaborole-5-carbohydrazide |
| SMILES | Cc1cc(C)cc(C(=O)N(NC(=O)c2ccc3c(c2F)COB3O)C(c2ccccc2)C(C)(C)C)c1 |
| InChI | InChI=1S/C28H30BFN2O4/c1-17-13-18(2)15-20(14-17)27(34)32(25(28(3,4)5)19-9-7-6-8-10-19)31-26(33)21-11-12-23-22(24(21)30)16-36-29(23)35/h6-15,25,35H,16H2,1-5H3,(H,31,33) |
| InChIKey | YGJMKEDDLQEIPG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|