C26H36BFN2O5 — CID 86282479
[3-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylpentan-3-yl]amino]carbamoyl]-6-(ethoxymethyl)-2-fluorophenyl]boronic acid (PubChem CID 86282479) has the molecular formula C26H36BFN2O5 and a molecular weight of 486.39 g/mol. Its IUPAC name is [3-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylpentan-3-yl]amino]carbamoyl]-6-(ethoxymethyl)-2-fluorophenyl]boronic acid.
| Compound Name | [3-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylpentan-3-yl]amino]carbamoyl]-6-(ethoxymethyl)-2-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 86282479 |
| Molecular Formula | C26H36BFN2O5 |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | [3-[[(3,5-dimethylbenzoyl)-[(3R)-2,2-dimethylpentan-3-yl]amino]carbamoyl]-6-(ethoxymethyl)-2-fluorophenyl]boronic acid |
| SMILES | CCOCc1ccc(C(=O)NN(C(=O)c2cc(C)cc(C)c2)[C@H](CC)C(C)(C)C)c(F)c1B(O)O |
| InChI | InChI=1S/C26H36BFN2O5/c1-8-21(26(5,6)7)30(25(32)19-13-16(3)12-17(4)14-19)29-24(31)20-11-10-18(15-35-9-2)22(23(20)28)27(33)34/h10-14,21,33-34H,8-9,15H2,1-7H3,(H,29,31)/t21-/m1/s1 |
| InChIKey | IFULGRSCCDESIS-OAQYLSRUSA-N |
| XLogP | 3.27 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|