About 4-(4-methoxyphenyl)butyl N-[(3S)-2-oxoazetidin-3-yl]carbamate
4-(4-methoxyphenyl)butyl N-[(3S)-2-oxoazetidin-3-yl]carbamate (PubChem CID 86282485) has the molecular formula C15H20N2O4
and a molecular weight of 292.33 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)butyl N-[(3S)-2-oxoazetidin-3-yl]carbamate.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)butyl N-[(3S)-2-oxoazetidin-3-yl]carbamate |
| PubChem CID | 86282485 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 4-(4-methoxyphenyl)butyl N-[(3S)-2-oxoazetidin-3-yl]carbamate |
| SMILES | COc1ccc(CCCCOC(=O)N[C@H]2CNC2=O)cc1 |
| InChI | InChI=1S/C15H20N2O4/c1-20-12-7-5-11(6-8-12)4-2-3-9-21-15(19)17-13-10-16-14(13)18/h5-8,13H,2-4,9-10H2,1H3,(H,16,18)(H,17,19)/t13-/m0/s1 |
| InChIKey | SJNDCCZZPWVOCC-ZDUSSCGKSA-N |
| XLogP | 1.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methoxyphenyl)butyl N-[(3S)-2-oxoazetidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)butyl N-[(3S)-2-oxoazetidin-3-yl]carbamate?
The IUPAC name of 4-(4-methoxyphenyl)butyl N-[(3S)-2-oxoazetidin-3-yl]carbamate (CID 86282485) is 4-(4-methoxyphenyl)butyl N-[(3S)-2-oxoazetidin-3-yl]carbamate.
What is the SMILES notation for 4-(4-methoxyphenyl)butyl N-[(3S)-2-oxoazetidin-3-yl]carbamate?
The canonical SMILES for 4-(4-methoxyphenyl)butyl N-[(3S)-2-oxoazetidin-3-yl]carbamate is COc1ccc(CCCCOC(=O)N[C@H]2CNC2=O)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)butyl N-[(3S)-2-oxoazetidin-3-yl]carbamate?
The InChIKey is SJNDCCZZPWVOCC-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H20N2O4/c1-20-12-7-5-11(6-8-12)4-2-3-9-21-15(19)17-13-10-16-14(13)18/h5-8,13H,2-4,9-10H2,1H3,(H,16,18)(H,17,19)/t13-/m0/s1.
What are the key properties of 4-(4-methoxyphenyl)butyl N-[(3S)-2-oxoazetidin-3-yl]carbamate?
4-(4-methoxyphenyl)butyl N-[(3S)-2-oxoazetidin-3-yl]carbamate has a molecular weight of 292.33 g/mol, XLogP of 1.24, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)butyl N-[(3S)-2-oxoazetidin-3-yl]carbamate is sourced from PubChem (CID 86282485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).