C18H20FN3O — CID 86282703
2-[4-(2-fluoroethoxymethyl)phenyl]-N,N-dimethylimidazo[1,2-a]pyridin-7-amine (PubChem CID 86282703) has the molecular formula C18H20FN3O and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-[4-(2-fluoroethoxymethyl)phenyl]-N,N-dimethylimidazo[1,2-a]pyridin-7-amine.
| Compound Name | 2-[4-(2-fluoroethoxymethyl)phenyl]-N,N-dimethylimidazo[1,2-a]pyridin-7-amine |
|---|---|
| PubChem CID | 86282703 |
| Molecular Formula | C18H20FN3O |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 2-[4-(2-fluoroethoxymethyl)phenyl]-N,N-dimethylimidazo[1,2-a]pyridin-7-amine |
| SMILES | CN(C)c1ccn2cc(-c3ccc(COCCF)cc3)nc2c1 |
| InChI | InChI=1S/C18H20FN3O/c1-21(2)16-7-9-22-12-17(20-18(22)11-16)15-5-3-14(4-6-15)13-23-10-8-19/h3-7,9,11-12H,8,10,13H2,1-2H3 |
| InChIKey | AVIKYDDUGJWBRT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|