C28H27Cl2NO4 — CID 86282738
(2R)-2-[(2S,5R,6S)-2-benzyl-5,6-bis(4-chlorophenyl)-3-oxomorpholin-4-yl]pentanoic acid (PubChem CID 86282738) has the molecular formula C28H27Cl2NO4 and a molecular weight of 512.43 g/mol. Its IUPAC name is (2R)-2-[(2S,5R,6S)-2-benzyl-5,6-bis(4-chlorophenyl)-3-oxomorpholin-4-yl]pentanoic acid.
| Compound Name | (2R)-2-[(2S,5R,6S)-2-benzyl-5,6-bis(4-chlorophenyl)-3-oxomorpholin-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 86282738 |
| Molecular Formula | C28H27Cl2NO4 |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | (2R)-2-[(2S,5R,6S)-2-benzyl-5,6-bis(4-chlorophenyl)-3-oxomorpholin-4-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)N1C(=O)[C@H](Cc2ccccc2)O[C@@H](c2ccc(Cl)cc2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H27Cl2NO4/c1-2-6-23(28(33)34)31-25(19-9-13-21(29)14-10-19)26(20-11-15-22(30)16-12-20)35-24(27(31)32)17-18-7-4-3-5-8-18/h3-5,7-16,23-26H,2,6,17H2,1H3,(H,33,34)/t23?,24-,25+,26-/m0/s1 |
| InChIKey | SCIHNVZRVLKGMQ-VGPBXHGJSA-N |
| XLogP | 6.50 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |