C27H34N4O2S — CID 86282848
6-[2-(2,3-dihydro-1-benzofuran-5-yl)ethylsulfanyl]-3,3-dimethyl-8-(4-methyl-1,4-diazepan-1-yl)-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile (PubChem CID 86282848) has the molecular formula C27H34N4O2S and a molecular weight of 478.66 g/mol. Its IUPAC name is 6-[2-(2,3-dihydro-1-benzofuran-5-yl)ethylsulfanyl]-3,3-dimethyl-8-(4-methyl-1,4-diazepan-1-yl)-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile.
| Compound Name | 6-[2-(2,3-dihydro-1-benzofuran-5-yl)ethylsulfanyl]-3,3-dimethyl-8-(4-methyl-1,4-diazepan-1-yl)-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 86282848 |
| Molecular Formula | C27H34N4O2S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 6-[2-(2,3-dihydro-1-benzofuran-5-yl)ethylsulfanyl]-3,3-dimethyl-8-(4-methyl-1,4-diazepan-1-yl)-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile |
| SMILES | CN1CCCN(c2nc(SCCc3ccc4c(c3)CCO4)c(C#N)c3c2COC(C)(C)C3)CC1 |
| InChI | InChI=1S/C27H34N4O2S/c1-27(2)16-21-22(17-28)26(34-14-8-19-5-6-24-20(15-19)7-13-32-24)29-25(23(21)18-33-27)31-10-4-9-30(3)11-12-31/h5-6,15H,4,7-14,16,18H2,1-3H3 |
| InChIKey | VBSSRAIGWFZMGX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |