About [5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3-phenyl-1H-indol-3-yl] acetate
[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3-phenyl-1H-indol-3-yl] acetate (PubChem CID 86282865) has the molecular formula C21H18N2O4
and a molecular weight of 362.39 g/mol. Its IUPAC name is [5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3-phenyl-1H-indol-3-yl] acetate.
Molecular Properties
| Compound Name | [5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3-phenyl-1H-indol-3-yl] acetate |
| PubChem CID | 86282865 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3-phenyl-1H-indol-3-yl] acetate |
| SMILES | CC(=O)OC1(c2ccccc2)C(=O)Nc2ccc(-c3c(C)noc3C)cc21 |
| InChI | InChI=1S/C21H18N2O4/c1-12-19(13(2)27-23-12)15-9-10-18-17(11-15)21(20(25)22-18,26-14(3)24)16-7-5-4-6-8-16/h4-11H,1-3H3,(H,22,25) |
| InChIKey | YJUUYNSHQAXQKU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3-phenyl-1H-indol-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3-phenyl-1H-indol-3-yl] acetate?
The IUPAC name of [5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3-phenyl-1H-indol-3-yl] acetate (CID 86282865) is [5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3-phenyl-1H-indol-3-yl] acetate.
What is the SMILES notation for [5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3-phenyl-1H-indol-3-yl] acetate?
The canonical SMILES for [5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3-phenyl-1H-indol-3-yl] acetate is CC(=O)OC1(c2ccccc2)C(=O)Nc2ccc(-c3c(C)noc3C)cc21.
What is the InChIKey of [5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3-phenyl-1H-indol-3-yl] acetate?
The InChIKey is YJUUYNSHQAXQKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O4/c1-12-19(13(2)27-23-12)15-9-10-18-17(11-15)21(20(25)22-18,26-14(3)24)16-7-5-4-6-8-16/h4-11H,1-3H3,(H,22,25).
What are the key properties of [5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3-phenyl-1H-indol-3-yl] acetate?
[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3-phenyl-1H-indol-3-yl] acetate has a molecular weight of 362.39 g/mol, XLogP of 3.72, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3-phenyl-1H-indol-3-yl] acetate is sourced from PubChem (CID 86282865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).