About 2-[(3S,4R)-3-(5-methylfuran-2-yl)-4-[(2-propoxyacetyl)amino]pyrrolidin-1-yl]acetamide
2-[(3S,4R)-3-(5-methylfuran-2-yl)-4-[(2-propoxyacetyl)amino]pyrrolidin-1-yl]acetamide (PubChem CID 86282983) has the molecular formula C16H25N3O4
and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-[(3S,4R)-3-(5-methylfuran-2-yl)-4-[(2-propoxyacetyl)amino]pyrrolidin-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[(3S,4R)-3-(5-methylfuran-2-yl)-4-[(2-propoxyacetyl)amino]pyrrolidin-1-yl]acetamide |
| PubChem CID | 86282983 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 2-[(3S,4R)-3-(5-methylfuran-2-yl)-4-[(2-propoxyacetyl)amino]pyrrolidin-1-yl]acetamide |
| SMILES | CCCOCC(=O)N[C@H]1CN(CC(N)=O)C[C@@H]1c1ccc(C)o1 |
| InChI | InChI=1S/C16H25N3O4/c1-3-6-22-10-16(21)18-13-8-19(9-15(17)20)7-12(13)14-5-4-11(2)23-14/h4-5,12-13H,3,6-10H2,1-2H3,(H2,17,20)(H,18,21)/t12-,13-/m0/s1 |
| InChIKey | BQKBEXPQFOLKIL-STQMWFEESA-N |
| XLogP | 0.38 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3S,4R)-3-(5-methylfuran-2-yl)-4-[(2-propoxyacetyl)amino]pyrrolidin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,4R)-3-(5-methylfuran-2-yl)-4-[(2-propoxyacetyl)amino]pyrrolidin-1-yl]acetamide?
The IUPAC name of 2-[(3S,4R)-3-(5-methylfuran-2-yl)-4-[(2-propoxyacetyl)amino]pyrrolidin-1-yl]acetamide (CID 86282983) is 2-[(3S,4R)-3-(5-methylfuran-2-yl)-4-[(2-propoxyacetyl)amino]pyrrolidin-1-yl]acetamide.
What is the SMILES notation for 2-[(3S,4R)-3-(5-methylfuran-2-yl)-4-[(2-propoxyacetyl)amino]pyrrolidin-1-yl]acetamide?
The canonical SMILES for 2-[(3S,4R)-3-(5-methylfuran-2-yl)-4-[(2-propoxyacetyl)amino]pyrrolidin-1-yl]acetamide is CCCOCC(=O)N[C@H]1CN(CC(N)=O)C[C@@H]1c1ccc(C)o1.
What is the InChIKey of 2-[(3S,4R)-3-(5-methylfuran-2-yl)-4-[(2-propoxyacetyl)amino]pyrrolidin-1-yl]acetamide?
The InChIKey is BQKBEXPQFOLKIL-STQMWFEESA-N. The full InChI is InChI=1S/C16H25N3O4/c1-3-6-22-10-16(21)18-13-8-19(9-15(17)20)7-12(13)14-5-4-11(2)23-14/h4-5,12-13H,3,6-10H2,1-2H3,(H2,17,20)(H,18,21)/t12-,13-/m0/s1.
What are the key properties of 2-[(3S,4R)-3-(5-methylfuran-2-yl)-4-[(2-propoxyacetyl)amino]pyrrolidin-1-yl]acetamide?
2-[(3S,4R)-3-(5-methylfuran-2-yl)-4-[(2-propoxyacetyl)amino]pyrrolidin-1-yl]acetamide has a molecular weight of 323.39 g/mol, XLogP of 0.38, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4R)-3-(5-methylfuran-2-yl)-4-[(2-propoxyacetyl)amino]pyrrolidin-1-yl]acetamide is sourced from PubChem (CID 86282983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).