C18H27N3O2 — CID 86283537
3-[[1-[3-[ethyl(methyl)amino]propanoyl]pyrrolidin-3-yl]methyl]benzamide (PubChem CID 86283537) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 3-[[1-[3-[ethyl(methyl)amino]propanoyl]pyrrolidin-3-yl]methyl]benzamide.
| Compound Name | 3-[[1-[3-[ethyl(methyl)amino]propanoyl]pyrrolidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 86283537 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 3-[[1-[3-[ethyl(methyl)amino]propanoyl]pyrrolidin-3-yl]methyl]benzamide |
| SMILES | CCN(C)CCC(=O)N1CCC(Cc2cccc(C(N)=O)c2)C1 |
| InChI | InChI=1S/C18H27N3O2/c1-3-20(2)9-8-17(22)21-10-7-15(13-21)11-14-5-4-6-16(12-14)18(19)23/h4-6,12,15H,3,7-11,13H2,1-2H3,(H2,19,23) |
| InChIKey | DWVFEUAVJKOWHZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |