About 2-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]-4-methylpyrimidine-5-carboxamide
2-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]-4-methylpyrimidine-5-carboxamide (PubChem CID 86283993) has the molecular formula C11H16FN5O
and a molecular weight of 253.28 g/mol. Its IUPAC name is 2-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]-4-methylpyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 2-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]-4-methylpyrimidine-5-carboxamide |
| PubChem CID | 86283993 |
| Molecular Formula | C11H16FN5O |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]-4-methylpyrimidine-5-carboxamide |
| SMILES | Cc1nc(N)ncc1C(=O)NC[C@@H]1C[C@H](F)CN1 |
| InChI | InChI=1S/C11H16FN5O/c1-6-9(5-16-11(13)17-6)10(18)15-4-8-2-7(12)3-14-8/h5,7-8,14H,2-4H2,1H3,(H,15,18)(H2,13,16,17)/t7-,8-/m0/s1 |
| InChIKey | YLCBBFYYPJMXTP-YUMQZZPRSA-N |
| XLogP | -0.20 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]-4-methylpyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]-4-methylpyrimidine-5-carboxamide?
The IUPAC name of 2-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]-4-methylpyrimidine-5-carboxamide (CID 86283993) is 2-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]-4-methylpyrimidine-5-carboxamide.
What is the SMILES notation for 2-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]-4-methylpyrimidine-5-carboxamide?
The canonical SMILES for 2-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]-4-methylpyrimidine-5-carboxamide is Cc1nc(N)ncc1C(=O)NC[C@@H]1C[C@H](F)CN1.
What is the InChIKey of 2-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]-4-methylpyrimidine-5-carboxamide?
The InChIKey is YLCBBFYYPJMXTP-YUMQZZPRSA-N. The full InChI is InChI=1S/C11H16FN5O/c1-6-9(5-16-11(13)17-6)10(18)15-4-8-2-7(12)3-14-8/h5,7-8,14H,2-4H2,1H3,(H,15,18)(H2,13,16,17)/t7-,8-/m0/s1.
What are the key properties of 2-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]-4-methylpyrimidine-5-carboxamide?
2-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]-4-methylpyrimidine-5-carboxamide has a molecular weight of 253.28 g/mol, XLogP of -0.20, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]-4-methylpyrimidine-5-carboxamide is sourced from PubChem (CID 86283993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).