About 3-[(3R,4S)-4-(4-methylpiperazin-1-yl)-1-(3-methyl-2-pyridinyl)piperidin-3-yl]propan-1-ol
3-[(3R,4S)-4-(4-methylpiperazin-1-yl)-1-(3-methyl-2-pyridinyl)piperidin-3-yl]propan-1-ol (PubChem CID 86284909) has the molecular formula C19H32N4O
and a molecular weight of 332.49 g/mol. Its IUPAC name is 3-[(3R,4S)-4-(4-methylpiperazin-1-yl)-1-(3-methyl-2-pyridinyl)piperidin-3-yl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(3R,4S)-4-(4-methylpiperazin-1-yl)-1-(3-methyl-2-pyridinyl)piperidin-3-yl]propan-1-ol |
| PubChem CID | 86284909 |
| Molecular Formula | C19H32N4O |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | 3-[(3R,4S)-4-(4-methylpiperazin-1-yl)-1-(3-methyl-2-pyridinyl)piperidin-3-yl]propan-1-ol |
| SMILES | Cc1cccnc1N1CC[C@H](N2CCN(C)CC2)[C@H](CCCO)C1 |
| InChI | InChI=1S/C19H32N4O/c1-16-5-3-8-20-19(16)23-9-7-18(17(15-23)6-4-14-24)22-12-10-21(2)11-13-22/h3,5,8,17-18,24H,4,6-7,9-15H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | MJGHSABGLNAWKM-MSOLQXFVSA-N |
| XLogP | 1.60 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(3R,4S)-4-(4-methylpiperazin-1-yl)-1-(3-methyl-2-pyridinyl)piperidin-3-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R,4S)-4-(4-methylpiperazin-1-yl)-1-(3-methyl-2-pyridinyl)piperidin-3-yl]propan-1-ol?
The IUPAC name of 3-[(3R,4S)-4-(4-methylpiperazin-1-yl)-1-(3-methyl-2-pyridinyl)piperidin-3-yl]propan-1-ol (CID 86284909) is 3-[(3R,4S)-4-(4-methylpiperazin-1-yl)-1-(3-methyl-2-pyridinyl)piperidin-3-yl]propan-1-ol.
What is the SMILES notation for 3-[(3R,4S)-4-(4-methylpiperazin-1-yl)-1-(3-methyl-2-pyridinyl)piperidin-3-yl]propan-1-ol?
The canonical SMILES for 3-[(3R,4S)-4-(4-methylpiperazin-1-yl)-1-(3-methyl-2-pyridinyl)piperidin-3-yl]propan-1-ol is Cc1cccnc1N1CC[C@H](N2CCN(C)CC2)[C@H](CCCO)C1.
What is the InChIKey of 3-[(3R,4S)-4-(4-methylpiperazin-1-yl)-1-(3-methyl-2-pyridinyl)piperidin-3-yl]propan-1-ol?
The InChIKey is MJGHSABGLNAWKM-MSOLQXFVSA-N. The full InChI is InChI=1S/C19H32N4O/c1-16-5-3-8-20-19(16)23-9-7-18(17(15-23)6-4-14-24)22-12-10-21(2)11-13-22/h3,5,8,17-18,24H,4,6-7,9-15H2,1-2H3/t17-,18+/m1/s1.
What are the key properties of 3-[(3R,4S)-4-(4-methylpiperazin-1-yl)-1-(3-methyl-2-pyridinyl)piperidin-3-yl]propan-1-ol?
3-[(3R,4S)-4-(4-methylpiperazin-1-yl)-1-(3-methyl-2-pyridinyl)piperidin-3-yl]propan-1-ol has a molecular weight of 332.49 g/mol, XLogP of 1.60, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R,4S)-4-(4-methylpiperazin-1-yl)-1-(3-methyl-2-pyridinyl)piperidin-3-yl]propan-1-ol is sourced from PubChem (CID 86284909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).