C12H17F4N3O2 — CID 86286068
N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide (PubChem CID 86286068) has the molecular formula C12H17F4N3O2 and a molecular weight of 311.28 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide.
| Compound Name | N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
|---|---|
| PubChem CID | 86286068 |
| Molecular Formula | C12H17F4N3O2 |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
| SMILES | Cc1n[nH]c(C)c1CCNC(=O)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C12H17F4N3O2/c1-7-9(8(2)19-18-7)3-4-17-10(20)5-21-6-12(15,16)11(13)14/h11H,3-6H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | RUILBNCXMHAFTM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|