About 2-(2,6-dimethoxy-3-pyridinyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid
2-(2,6-dimethoxy-3-pyridinyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid (PubChem CID 86286720) has the molecular formula C15H23N3O4
and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-(2,6-dimethoxy-3-pyridinyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(2,6-dimethoxy-3-pyridinyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid |
| PubChem CID | 86286720 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-(2,6-dimethoxy-3-pyridinyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid |
| SMILES | COc1ccc(C(C(=O)O)N2CCCN(C)CC2)c(OC)n1 |
| InChI | InChI=1S/C15H23N3O4/c1-17-7-4-8-18(10-9-17)13(15(19)20)11-5-6-12(21-2)16-14(11)22-3/h5-6,13H,4,7-10H2,1-3H3,(H,19,20) |
| InChIKey | IPPISOPELHDBHO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2,6-dimethoxy-3-pyridinyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethoxy-3-pyridinyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid?
The IUPAC name of 2-(2,6-dimethoxy-3-pyridinyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid (CID 86286720) is 2-(2,6-dimethoxy-3-pyridinyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid.
What is the SMILES notation for 2-(2,6-dimethoxy-3-pyridinyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid?
The canonical SMILES for 2-(2,6-dimethoxy-3-pyridinyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid is COc1ccc(C(C(=O)O)N2CCCN(C)CC2)c(OC)n1.
What is the InChIKey of 2-(2,6-dimethoxy-3-pyridinyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid?
The InChIKey is IPPISOPELHDBHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O4/c1-17-7-4-8-18(10-9-17)13(15(19)20)11-5-6-12(21-2)16-14(11)22-3/h5-6,13H,4,7-10H2,1-3H3,(H,19,20).
What are the key properties of 2-(2,6-dimethoxy-3-pyridinyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid?
2-(2,6-dimethoxy-3-pyridinyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid has a molecular weight of 309.37 g/mol, XLogP of 0.86, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethoxy-3-pyridinyl)-2-(4-methyl-1,4-diazepan-1-yl)acetic acid is sourced from PubChem (CID 86286720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).