C16H18N4O4 — CID 86286995
N-[(2,4-dioxo-1H-pyrimidin-5-yl)methyl]-2-morpholin-4-ylbenzamide (PubChem CID 86286995) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is N-[(2,4-dioxo-1H-pyrimidin-5-yl)methyl]-2-morpholin-4-ylbenzamide.
| Compound Name | N-[(2,4-dioxo-1H-pyrimidin-5-yl)methyl]-2-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 86286995 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N-[(2,4-dioxo-1H-pyrimidin-5-yl)methyl]-2-morpholin-4-ylbenzamide |
| SMILES | O=C(NCc1c[nH]c(=O)[nH]c1=O)c1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C16H18N4O4/c21-14-11(10-18-16(23)19-14)9-17-15(22)12-3-1-2-4-13(12)20-5-7-24-8-6-20/h1-4,10H,5-9H2,(H,17,22)(H2,18,19,21,23) |
| InChIKey | QWDWCOUKNCHISW-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |