C15H23NO5S2 — CID 86287084
4-(butylsulfanylmethyl)-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-methylfuran-2-carboxamide (PubChem CID 86287084) has the molecular formula C15H23NO5S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-(butylsulfanylmethyl)-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-methylfuran-2-carboxamide.
| Compound Name | 4-(butylsulfanylmethyl)-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 86287084 |
| Molecular Formula | C15H23NO5S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 4-(butylsulfanylmethyl)-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-methylfuran-2-carboxamide |
| SMILES | CCCCSCc1cc(C(=O)N[C@@H]2CS(=O)(=O)C[C@H]2O)oc1C |
| InChI | InChI=1S/C15H23NO5S2/c1-3-4-5-22-7-11-6-14(21-10(11)2)15(18)16-12-8-23(19,20)9-13(12)17/h6,12-13,17H,3-5,7-9H2,1-2H3,(H,16,18)/t12-,13-/m1/s1 |
| InChIKey | VBRLEHOLGPBMIX-CHWSQXEVSA-N |
| XLogP | 1.51 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|